C11H16N2O2S2 — CID 575232
2-(2,5-dioxopyrrolidin-1-yl)ethyl pyrrolidine-1-carbodithioate (PubChem CID 575232) has the molecular formula C11H16N2O2S2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrolidin-1-yl)ethyl pyrrolidine-1-carbodithioate.
| Compound Name | 2-(2,5-dioxopyrrolidin-1-yl)ethyl pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 575232 |
| Molecular Formula | C11H16N2O2S2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-(2,5-dioxopyrrolidin-1-yl)ethyl pyrrolidine-1-carbodithioate |
| SMILES | O=C1CCC(=O)N1CCSC(=S)N1CCCC1 |
| InChI | InChI=1S/C11H16N2O2S2/c14-9-3-4-10(15)13(9)7-8-17-11(16)12-5-1-2-6-12/h1-8H2 |
| InChIKey | VIWJXMRPIZCGMS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|