About 1,6-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)hexane-1,6-dione
1,6-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)hexane-1,6-dione (PubChem CID 4866772) has the molecular formula C12H16N2O2S4
and a molecular weight of 348.54 g/mol. Its IUPAC name is 1,6-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)hexane-1,6-dione.
Molecular Properties
| Compound Name | 1,6-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)hexane-1,6-dione |
| PubChem CID | 4866772 |
| Molecular Formula | C12H16N2O2S4 |
| Molecular Weight | 348.54 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 1,6-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)hexane-1,6-dione |
| SMILES | O=C(CCCCC(=O)N1CCSC1=S)N1CCSC1=S |
| InChI | InChI=1S/C12H16N2O2S4/c15-9(13-5-7-19-11(13)17)3-1-2-4-10(16)14-6-8-20-12(14)18/h1-8H2 |
| InChIKey | KWQQSWINFGXVOL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.54 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,6-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)hexane-1,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)hexane-1,6-dione?
The IUPAC name of 1,6-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)hexane-1,6-dione (CID 4866772) is 1,6-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)hexane-1,6-dione.
What is the SMILES notation for 1,6-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)hexane-1,6-dione?
The canonical SMILES for 1,6-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)hexane-1,6-dione is O=C(CCCCC(=O)N1CCSC1=S)N1CCSC1=S.
What is the InChIKey of 1,6-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)hexane-1,6-dione?
The InChIKey is KWQQSWINFGXVOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O2S4/c15-9(13-5-7-19-11(13)17)3-1-2-4-10(16)14-6-8-20-12(14)18/h1-8H2.
What are the key properties of 1,6-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)hexane-1,6-dione?
1,6-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)hexane-1,6-dione has a molecular weight of 348.54 g/mol, XLogP of 2.27, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)hexane-1,6-dione is sourced from PubChem (CID 4866772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).