C12H16N2O2S4 — CID 4866772
1,6-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)hexane-1,6-dione (PubChem CID 4866772) has the molecular formula C12H16N2O2S4 and a molecular weight of 348.54 g/mol. Its IUPAC name is 1,6-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)hexane-1,6-dione.
| Compound Name | 1,6-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)hexane-1,6-dione |
|---|---|
| PubChem CID | 4866772 |
| Molecular Formula | C12H16N2O2S4 |
| Molecular Weight | 348.54 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 1,6-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)hexane-1,6-dione |
| SMILES | O=C(CCCCC(=O)N1CCSC1=S)N1CCSC1=S |
| InChI | InChI=1S/C12H16N2O2S4/c15-9(13-5-7-19-11(13)17)3-1-2-4-10(16)14-6-8-20-12(14)18/h1-8H2 |
| InChIKey | KWQQSWINFGXVOL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.54 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|