C12H16N2O2S6 — CID 134817414
3-[[3-oxo-3-(2-sulfanylidene-1,3-thiazolidin-3-yl)propyl]disulfanyl]-1-(2-sulfanylidene-1,3-thiazolidin-3-yl)propan-1-one (PubChem CID 134817414) has the molecular formula C12H16N2O2S6 and a molecular weight of 412.67 g/mol. Its IUPAC name is 3-[[3-oxo-3-(2-sulfanylidene-1,3-thiazolidin-3-yl)propyl]disulfanyl]-1-(2-sulfanylidene-1,3-thiazolidin-3-yl)propan-1-one.
| Compound Name | 3-[[3-oxo-3-(2-sulfanylidene-1,3-thiazolidin-3-yl)propyl]disulfanyl]-1-(2-sulfanylidene-1,3-thiazolidin-3-yl)propan-1-one |
|---|---|
| PubChem CID | 134817414 |
| Molecular Formula | C12H16N2O2S6 |
| Molecular Weight | 412.67 g/mol |
| Exact Mass | 411.95 |
| IUPAC Name | 3-[[3-oxo-3-(2-sulfanylidene-1,3-thiazolidin-3-yl)propyl]disulfanyl]-1-(2-sulfanylidene-1,3-thiazolidin-3-yl)propan-1-one |
| SMILES | O=C(CCSSCCC(=O)N1CCSC1=S)N1CCSC1=S |
| InChI | InChI=1S/C12H16N2O2S6/c15-9(13-3-7-19-11(13)17)1-5-21-22-6-2-10(16)14-4-8-20-12(14)18/h1-8H2 |
| InChIKey | YLWLEZCKUTYMGX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.67 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|