C11H14N2O2S4 — CID 15499832
1,5-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)pentane-1,5-dione (PubChem CID 15499832) has the molecular formula C11H14N2O2S4 and a molecular weight of 334.51 g/mol. Its IUPAC name is 1,5-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)pentane-1,5-dione.
| Compound Name | 1,5-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)pentane-1,5-dione |
|---|---|
| PubChem CID | 15499832 |
| Molecular Formula | C11H14N2O2S4 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 1,5-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)pentane-1,5-dione |
| SMILES | O=C(CCCC(=O)N1CCSC1=S)N1CCSC1=S |
| InChI | InChI=1S/C11H14N2O2S4/c14-8(12-4-6-18-10(12)16)2-1-3-9(15)13-5-7-19-11(13)17/h1-7H2 |
| InChIKey | RCNUBRRGKNQIMQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|