C10H12N2O2S4 — CID 6993310
(5S)-3-ethyl-5-[(5S)-3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 6993310) has the molecular formula C10H12N2O2S4 and a molecular weight of 320.49 g/mol. Its IUPAC name is (5S)-3-ethyl-5-[(5S)-3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5S)-3-ethyl-5-[(5S)-3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6993310 |
| Molecular Formula | C10H12N2O2S4 |
| Molecular Weight | 320.49 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | (5S)-3-ethyl-5-[(5S)-3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)[C@@H]([C@H]2SC(=S)N(CC)C2=O)SC1=S |
| InChI | InChI=1S/C10H12N2O2S4/c1-3-11-7(13)5(17-9(11)15)6-8(14)12(4-2)10(16)18-6/h5-6H,3-4H2,1-2H3/t5-,6-/m1/s1 |
| InChIKey | LSPWFIQGPMHETM-PHDIDXHHSA-N |
| XLogP | 1.48 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.49 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|