C9H15NOS2 — CID 12675044
1-(2-sulfanylidene-1,3-thiazolidin-3-yl)hexan-1-one (PubChem CID 12675044) has the molecular formula C9H15NOS2 and a molecular weight of 217.36 g/mol. Its IUPAC name is 1-(2-sulfanylidene-1,3-thiazolidin-3-yl)hexan-1-one.
| Compound Name | 1-(2-sulfanylidene-1,3-thiazolidin-3-yl)hexan-1-one |
|---|---|
| PubChem CID | 12675044 |
| Molecular Formula | C9H15NOS2 |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 1-(2-sulfanylidene-1,3-thiazolidin-3-yl)hexan-1-one |
| SMILES | CCCCCC(=O)N1CCSC1=S |
| InChI | InChI=1S/C9H15NOS2/c1-2-3-4-5-8(11)10-6-7-13-9(10)12/h2-7H2,1H3 |
| InChIKey | FKSYDEOSCLGMTL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|