C8H13NO2S — CID 59816498
3-pentanoyl-1,3-thiazolidin-2-one (PubChem CID 59816498) has the molecular formula C8H13NO2S and a molecular weight of 187.26 g/mol. Its IUPAC name is 3-pentanoyl-1,3-thiazolidin-2-one.
| Compound Name | 3-pentanoyl-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 59816498 |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 3-pentanoyl-1,3-thiazolidin-2-one |
| SMILES | CCCCC(=O)N1CCSC1=O |
| InChI | InChI=1S/C8H13NO2S/c1-2-3-4-7(10)9-5-6-12-8(9)11/h2-6H2,1H3 |
| InChIKey | FTJRDQNKDOESJZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|