C50H30N4 — CID 163411233
6-(11,12-diphenylindolo[2,3-a]carbazol-4-yl)-3-isocyano-2,4-diphenylbenzonitrile (PubChem CID 163411233) has the molecular formula C50H30N4 and a molecular weight of 686.82 g/mol. Its IUPAC name is 6-(11,12-diphenylindolo[2,3-a]carbazol-4-yl)-3-isocyano-2,4-diphenylbenzonitrile.
| Compound Name | 6-(11,12-diphenylindolo[2,3-a]carbazol-4-yl)-3-isocyano-2,4-diphenylbenzonitrile |
|---|---|
| PubChem CID | 163411233 |
| Molecular Formula | C50H30N4 |
| Molecular Weight | 686.82 g/mol |
| Exact Mass | 686.25 |
| IUPAC Name | 6-(11,12-diphenylindolo[2,3-a]carbazol-4-yl)-3-isocyano-2,4-diphenylbenzonitrile |
| SMILES | [C-]#[N+]c1c(-c2ccccc2)cc(-c2cccc3c2c2ccc4c5ccccc5n(-c5ccccc5)c4c2n3-c2ccccc2)c(C#N)c1-c1ccccc1 |
| InChI | InChI=1S/C50H30N4/c1-52-48-41(33-17-6-2-7-18-33)31-42(43(32-51)46(48)34-19-8-3-9-20-34)38-26-16-28-45-47(38)40-30-29-39-37-25-14-15-27-44(37)53(35-21-10-4-11-22-35)49(39)50(40)54(45)36-23-12-5-13-24-36/h2-31H |
| InChIKey | HBDXAGUQCZGQFZ-UHFFFAOYSA-N |
| XLogP | 13.30 |
| TPSA | 38.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.82 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|