C57H33N5 — CID 163474960
4-[4-(5,12-diphenylindolo[2,3-g]carbazol-4-yl)-3-isocyanophenyl]-2,6-diphenylbenzene-1,3-dicarbonitrile (PubChem CID 163474960) has the molecular formula C57H33N5 and a molecular weight of 787.93 g/mol. Its IUPAC name is 4-[4-(5,12-diphenylindolo[2,3-g]carbazol-4-yl)-3-isocyanophenyl]-2,6-diphenylbenzene-1,3-dicarbonitrile.
| Compound Name | 4-[4-(5,12-diphenylindolo[2,3-g]carbazol-4-yl)-3-isocyanophenyl]-2,6-diphenylbenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 163474960 |
| Molecular Formula | C57H33N5 |
| Molecular Weight | 787.93 g/mol |
| Exact Mass | 787.27 |
| IUPAC Name | 4-[4-(5,12-diphenylindolo[2,3-g]carbazol-4-yl)-3-isocyanophenyl]-2,6-diphenylbenzene-1,3-dicarbonitrile |
| SMILES | [C-]#[N+]c1cc(-c2cc(-c3ccccc3)c(C#N)c(-c3ccccc3)c2C#N)ccc1-c1cccc2c3c(ccc4c5ccccc5n(-c5ccccc5)c43)n(-c3ccccc3)c12 |
| InChI | InChI=1S/C57H33N5/c1-60-51-33-39(48-34-47(37-17-6-2-7-18-37)49(35-58)54(50(48)36-59)38-19-8-3-9-20-38)29-30-42(51)44-26-16-27-46-55-53(62(56(44)46)41-23-12-5-13-24-41)32-31-45-43-25-14-15-28-52(43)61(57(45)55)40-21-10-4-11-22-40/h2-34H |
| InChIKey | IQFPBQPCBUJQJW-UHFFFAOYSA-N |
| XLogP | 14.84 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.93 |
| LogP ≤ 5 | 14.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|