C56H32N6 — CID 163663390
2-[4-(5,11-diphenylindolo[2,3-h]carbazol-4-yl)-3-isocyanophenyl]-4,6-diphenylpyridine-3,5-dicarbonitrile (PubChem CID 163663390) has the molecular formula C56H32N6 and a molecular weight of 788.91 g/mol. Its IUPAC name is 2-[4-(5,11-diphenylindolo[2,3-h]carbazol-4-yl)-3-isocyanophenyl]-4,6-diphenylpyridine-3,5-dicarbonitrile.
| Compound Name | 2-[4-(5,11-diphenylindolo[2,3-h]carbazol-4-yl)-3-isocyanophenyl]-4,6-diphenylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 163663390 |
| Molecular Formula | C56H32N6 |
| Molecular Weight | 788.91 g/mol |
| Exact Mass | 788.27 |
| IUPAC Name | 2-[4-(5,11-diphenylindolo[2,3-h]carbazol-4-yl)-3-isocyanophenyl]-4,6-diphenylpyridine-3,5-dicarbonitrile |
| SMILES | [C-]#[N+]c1cc(-c2nc(-c3ccccc3)c(C#N)c(-c3ccccc3)c2C#N)ccc1-c1cccc2c3cc4c(cc3n(-c3ccccc3)c12)c1ccccc1n4-c1ccccc1 |
| InChI | InChI=1S/C56H32N6/c1-59-49-31-38(55-48(35-58)53(36-17-6-2-7-18-36)47(34-57)54(60-55)37-19-8-3-9-20-37)29-30-41(49)43-26-16-27-44-46-33-51-45(32-52(46)62(56(43)44)40-23-12-5-13-24-40)42-25-14-15-28-50(42)61(51)39-21-10-4-11-22-39/h2-33H |
| InChIKey | CKJDHZRTINAIQB-UHFFFAOYSA-N |
| XLogP | 14.24 |
| TPSA | 74.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.91 |
| LogP ≤ 5 | 14.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|