C15H20NO2+ — CID 163415334
[3-(2,2-dimethylpropyl)-4-methyl-2-oxochromen-7-yl]azanium (PubChem CID 163415334) has the molecular formula C15H20NO2+ and a molecular weight of 246.33 g/mol. Its IUPAC name is [3-(2,2-dimethylpropyl)-4-methyl-2-oxochromen-7-yl]azanium.
| Compound Name | [3-(2,2-dimethylpropyl)-4-methyl-2-oxochromen-7-yl]azanium |
|---|---|
| PubChem CID | 163415334 |
| Molecular Formula | C15H20NO2+ |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | [3-(2,2-dimethylpropyl)-4-methyl-2-oxochromen-7-yl]azanium |
| SMILES | Cc1c(CC(C)(C)C)c(=O)oc2cc([NH3+])ccc12 |
| InChI | InChI=1S/C15H19NO2/c1-9-11-6-5-10(16)7-13(11)18-14(17)12(9)8-15(2,3)4/h5-7H,8,16H2,1-4H3/p+1 |
| InChIKey | ADXIEMUZOCDINJ-UHFFFAOYSA-O |
| XLogP | 2.56 |
| TPSA | 57.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|