C32H40N4O3 — CID 163417876
(1S)-1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-[4-[1-(2-iminopiperazin-1-yl)ethyl]phenyl]-6-methoxy-7-propan-2-yloxy-1,4-dihydroisoquinolin-3-one (PubChem CID 163417876) has the molecular formula C32H40N4O3 and a molecular weight of 528.70 g/mol. Its IUPAC name is (1S)-1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-[4-[1-(2-iminopiperazin-1-yl)ethyl]phenyl]-6-methoxy-7-propan-2-yloxy-1,4-dihydroisoquinolin-3-one.
| Compound Name | (1S)-1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-[4-[1-(2-iminopiperazin-1-yl)ethyl]phenyl]-6-methoxy-7-propan-2-yloxy-1,4-dihydroisoquinolin-3-one |
|---|---|
| PubChem CID | 163417876 |
| Molecular Formula | C32H40N4O3 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | (1S)-1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-[4-[1-(2-iminopiperazin-1-yl)ethyl]phenyl]-6-methoxy-7-propan-2-yloxy-1,4-dihydroisoquinolin-3-one |
| SMILES | [H]/N=C1\CNCCN1C(C)c1ccc(N2C(=O)Cc3cc(OC)c(OC(C)C)cc3[C@@H]2C(/C=C\C)=C/C=C)cc1 |
| InChI | InChI=1S/C32H40N4O3/c1-7-9-24(10-8-2)32-27-19-29(39-21(3)4)28(38-6)17-25(27)18-31(37)36(32)26-13-11-23(12-14-26)22(5)35-16-15-34-20-30(35)33/h7-14,17,19,21-22,32-34H,1,15-16,18,20H2,2-6H3/b10-8-,24-9+,33-30+/t22?,32-/m0/s1 |
| InChIKey | AFYZLJONFVXMJX-BYMOMITDSA-N |
| XLogP | 5.74 |
| TPSA | 77.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|