C27H28ClNO3S — CID 166752962
1-(4-chlorophenyl)-6-methoxy-7-propan-2-yloxy-2-[4-(2-sulfanylethyl)phenyl]-1,4-dihydroisoquinolin-3-one (PubChem CID 166752962) has the molecular formula C27H28ClNO3S and a molecular weight of 482.05 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-6-methoxy-7-propan-2-yloxy-2-[4-(2-sulfanylethyl)phenyl]-1,4-dihydroisoquinolin-3-one.
| Compound Name | 1-(4-chlorophenyl)-6-methoxy-7-propan-2-yloxy-2-[4-(2-sulfanylethyl)phenyl]-1,4-dihydroisoquinolin-3-one |
|---|---|
| PubChem CID | 166752962 |
| Molecular Formula | C27H28ClNO3S |
| Molecular Weight | 482.05 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 1-(4-chlorophenyl)-6-methoxy-7-propan-2-yloxy-2-[4-(2-sulfanylethyl)phenyl]-1,4-dihydroisoquinolin-3-one |
| SMILES | COc1cc2c(cc1OC(C)C)C(c1ccc(Cl)cc1)N(c1ccc(CCS)cc1)C(=O)C2 |
| InChI | InChI=1S/C27H28ClNO3S/c1-17(2)32-25-16-23-20(14-24(25)31-3)15-26(30)29(22-10-4-18(5-11-22)12-13-33)27(23)19-6-8-21(28)9-7-19/h4-11,14,16-17,27,33H,12-13,15H2,1-3H3 |
| InChIKey | FXLSLBJUFSZMSM-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 38.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.05 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|