C24H22BrClN2O3 — CID 58438228
2-(6-bromo-3-pyridinyl)-1-(4-chlorophenyl)-6-methoxy-7-propan-2-yloxy-1,4-dihydroisoquinolin-3-one (PubChem CID 58438228) has the molecular formula C24H22BrClN2O3 and a molecular weight of 501.81 g/mol. Its IUPAC name is 2-(6-bromo-3-pyridinyl)-1-(4-chlorophenyl)-6-methoxy-7-propan-2-yloxy-1,4-dihydroisoquinolin-3-one.
| Compound Name | 2-(6-bromo-3-pyridinyl)-1-(4-chlorophenyl)-6-methoxy-7-propan-2-yloxy-1,4-dihydroisoquinolin-3-one |
|---|---|
| PubChem CID | 58438228 |
| Molecular Formula | C24H22BrClN2O3 |
| Molecular Weight | 501.81 g/mol |
| Exact Mass | 500.05 |
| IUPAC Name | 2-(6-bromo-3-pyridinyl)-1-(4-chlorophenyl)-6-methoxy-7-propan-2-yloxy-1,4-dihydroisoquinolin-3-one |
| SMILES | COc1cc2c(cc1OC(C)C)C(c1ccc(Cl)cc1)N(c1ccc(Br)nc1)C(=O)C2 |
| InChI | InChI=1S/C24H22BrClN2O3/c1-14(2)31-21-12-19-16(10-20(21)30-3)11-23(29)28(18-8-9-22(25)27-13-18)24(19)15-4-6-17(26)7-5-15/h4-10,12-14,24H,11H2,1-3H3 |
| InChIKey | NPPJZVWHLWNZBA-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.81 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|