C37H44N2O7 — CID 163424012
(4R,4aR,5aR,12aR)-9-tert-butyl-3,10,12,12a-tetrahydroxy-4a,5a-dimethyl-1,11-dioxo-4-propan-2-yl-7-quinolin-3-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 163424012) has the molecular formula C37H44N2O7 and a molecular weight of 628.77 g/mol. Its IUPAC name is (4R,4aR,5aR,12aR)-9-tert-butyl-3,10,12,12a-tetrahydroxy-4a,5a-dimethyl-1,11-dioxo-4-propan-2-yl-7-quinolin-3-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aR,12aR)-9-tert-butyl-3,10,12,12a-tetrahydroxy-4a,5a-dimethyl-1,11-dioxo-4-propan-2-yl-7-quinolin-3-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 163424012 |
| Molecular Formula | C37H44N2O7 |
| Molecular Weight | 628.77 g/mol |
| Exact Mass | 628.31 |
| IUPAC Name | (4R,4aR,5aR,12aR)-9-tert-butyl-3,10,12,12a-tetrahydroxy-4a,5a-dimethyl-1,11-dioxo-4-propan-2-yl-7-quinolin-3-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | CC(C)[C@H]1C(O)C(C(N)=O)C(=O)[C@]2(O)C(O)C3C(=O)c4c(O)c(C(C)(C)C)cc(-c5cnc6ccccc6c5)c4C[C@]3(C)C[C@]12C |
| InChI | InChI=1S/C37H44N2O7/c1-17(2)26-30(42)25(33(38)45)31(43)37(46)32(44)27-29(41)24-21(14-35(27,6)16-36(26,37)7)20(13-22(28(24)40)34(3,4)5)19-12-18-10-8-9-11-23(18)39-15-19/h8-13,15,17,25-27,30,32,40,42,44,46H,14,16H2,1-7H3,(H2,38,45)/t25?,26-,27?,30?,32?,35+,36+,37-/m0/s1 |
| InChIKey | AKXPWGSHWWIMAU-IZGZNARASA-N |
| XLogP | 4.09 |
| TPSA | 171.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.77 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|