C19H35NO4 — CID 163424643
tert-butyl (3R)-3-[6-(2-methyl-1,3-dioxolan-2-yl)hexyl]pyrrolidine-1-carboxylate (PubChem CID 163424643) has the molecular formula C19H35NO4 and a molecular weight of 341.49 g/mol. Its IUPAC name is tert-butyl (3R)-3-[6-(2-methyl-1,3-dioxolan-2-yl)hexyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[6-(2-methyl-1,3-dioxolan-2-yl)hexyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 163424643 |
| Molecular Formula | C19H35NO4 |
| Molecular Weight | 341.49 g/mol |
| Exact Mass | 341.26 |
| IUPAC Name | tert-butyl (3R)-3-[6-(2-methyl-1,3-dioxolan-2-yl)hexyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](CCCCCCC2(C)OCCO2)C1 |
| InChI | InChI=1S/C19H35NO4/c1-18(2,3)24-17(21)20-12-10-16(15-20)9-7-5-6-8-11-19(4)22-13-14-23-19/h16H,5-15H2,1-4H3/t16-/m1/s1 |
| InChIKey | ALKLZRIXDZQWGP-MRXNPFEDSA-N |
| XLogP | 4.35 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|