C38H25N3O2 — CID 163425591
7-(6-dibenzofuran-3-yl-2-phenylpyrimidin-4-yl)-9,9-dimethylxanthene-3-carbonitrile (PubChem CID 163425591) has the molecular formula C38H25N3O2 and a molecular weight of 555.64 g/mol. Its IUPAC name is 7-(6-dibenzofuran-3-yl-2-phenylpyrimidin-4-yl)-9,9-dimethylxanthene-3-carbonitrile.
| Compound Name | 7-(6-dibenzofuran-3-yl-2-phenylpyrimidin-4-yl)-9,9-dimethylxanthene-3-carbonitrile |
|---|---|
| PubChem CID | 163425591 |
| Molecular Formula | C38H25N3O2 |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | 7-(6-dibenzofuran-3-yl-2-phenylpyrimidin-4-yl)-9,9-dimethylxanthene-3-carbonitrile |
| SMILES | CC1(C)c2ccc(C#N)cc2Oc2ccc(-c3cc(-c4ccc5c(c4)oc4ccccc45)nc(-c4ccccc4)n3)cc21 |
| InChI | InChI=1S/C38H25N3O2/c1-38(2)29-16-12-23(22-39)18-36(29)43-34-17-14-25(19-30(34)38)31-21-32(41-37(40-31)24-8-4-3-5-9-24)26-13-15-28-27-10-6-7-11-33(27)42-35(28)20-26/h3-21H,1-2H3 |
| InChIKey | AMFQSVKXIUXMHM-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 71.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |