C57H61N3 — CID 163426970
N-[3-(4a,9a-dimethyl-1,2,3,4-tetrahydrocarbazol-9-yl)phenyl]-N-[3-(6-ethyl-1-phenylindol-2-yl)-5-methylphenyl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-amine (PubChem CID 163426970) has the molecular formula C57H61N3 and a molecular weight of 788.14 g/mol. Its IUPAC name is N-[3-(4a,9a-dimethyl-1,2,3,4-tetrahydrocarbazol-9-yl)phenyl]-N-[3-(6-ethyl-1-phenylindol-2-yl)-5-methylphenyl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-amine.
| Compound Name | N-[3-(4a,9a-dimethyl-1,2,3,4-tetrahydrocarbazol-9-yl)phenyl]-N-[3-(6-ethyl-1-phenylindol-2-yl)-5-methylphenyl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-amine |
|---|---|
| PubChem CID | 163426970 |
| Molecular Formula | C57H61N3 |
| Molecular Weight | 788.14 g/mol |
| Exact Mass | 787.49 |
| IUPAC Name | N-[3-(4a,9a-dimethyl-1,2,3,4-tetrahydrocarbazol-9-yl)phenyl]-N-[3-(6-ethyl-1-phenylindol-2-yl)-5-methylphenyl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-amine |
| SMILES | CCc1ccc2cc(-c3cc(C)cc(N(c4cccc(N5c6ccccc6C6(C)CCCCC56C)c4)c4ccc5c(c4)C(C)(C)CCC5(C)C)c3)n(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C57H61N3/c1-9-40-24-25-41-36-53(59(52(41)34-40)43-18-11-10-12-19-43)42-32-39(2)33-47(35-42)58(45-26-27-48-50(38-45)55(5,6)31-30-54(48,3)4)44-20-17-21-46(37-44)60-51-23-14-13-22-49(51)56(7)28-15-16-29-57(56,60)8/h10-14,17-27,32-38H,9,15-16,28-31H2,1-8H3 |
| InChIKey | ANJFPPNRHLHQPZ-UHFFFAOYSA-N |
| XLogP | 15.73 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.14 |
| LogP ≤ 5 | 15.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |