C19H20ClNO3S — CID 163427950
7-chloro-2-[(E)-4-phenoxybut-1-enyl]sulfonyl-3,4-dihydro-1H-isoquinoline (PubChem CID 163427950) has the molecular formula C19H20ClNO3S and a molecular weight of 377.89 g/mol. Its IUPAC name is 7-chloro-2-[(E)-4-phenoxybut-1-enyl]sulfonyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 7-chloro-2-[(E)-4-phenoxybut-1-enyl]sulfonyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 163427950 |
| Molecular Formula | C19H20ClNO3S |
| Molecular Weight | 377.89 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 7-chloro-2-[(E)-4-phenoxybut-1-enyl]sulfonyl-3,4-dihydro-1H-isoquinoline |
| SMILES | O=S(=O)(/C=C/CCOc1ccccc1)N1CCc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C19H20ClNO3S/c20-18-9-8-16-10-11-21(15-17(16)14-18)25(22,23)13-5-4-12-24-19-6-2-1-3-7-19/h1-3,5-9,13-14H,4,10-12,15H2/b13-5+ |
| InChIKey | AODCHLAKFGQFMC-WLRTZDKTSA-N |
| XLogP | 4.01 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.89 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|