C15H28F2N2O — CID 163428700
1-[(1S,6R)-6-ethoxy-2,2-difluorocyclohexyl]-4-propan-2-ylpiperazine (PubChem CID 163428700) has the molecular formula C15H28F2N2O and a molecular weight of 290.40 g/mol. Its IUPAC name is 1-[(1S,6R)-6-ethoxy-2,2-difluorocyclohexyl]-4-propan-2-ylpiperazine.
| Compound Name | 1-[(1S,6R)-6-ethoxy-2,2-difluorocyclohexyl]-4-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 163428700 |
| Molecular Formula | C15H28F2N2O |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 1-[(1S,6R)-6-ethoxy-2,2-difluorocyclohexyl]-4-propan-2-ylpiperazine |
| SMILES | CCO[C@@H]1CCCC(F)(F)[C@H]1N1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C15H28F2N2O/c1-4-20-13-6-5-7-15(16,17)14(13)19-10-8-18(9-11-19)12(2)3/h12-14H,4-11H2,1-3H3/t13-,14+/m1/s1 |
| InChIKey | GHYMPMARNGUBPA-KGLIPLIRSA-N |
| XLogP | 2.61 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |