C10H19NO — CID 163429217
N-[2-[(3Z)-penta-1,3-dien-2-yl]oxyethyl]propan-2-amine (PubChem CID 163429217) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is N-[2-[(3Z)-penta-1,3-dien-2-yl]oxyethyl]propan-2-amine.
| Compound Name | N-[2-[(3Z)-penta-1,3-dien-2-yl]oxyethyl]propan-2-amine |
|---|---|
| PubChem CID | 163429217 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | N-[2-[(3Z)-penta-1,3-dien-2-yl]oxyethyl]propan-2-amine |
| SMILES | C=C(/C=C\C)OCCNC(C)C |
| InChI | InChI=1S/C10H19NO/c1-5-6-10(4)12-8-7-11-9(2)3/h5-6,9,11H,4,7-8H2,1-3H3/b6-5- |
| InChIKey | APAWLEXNSIXNPC-WAYWQWQTSA-N |
| XLogP | 2.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|