C16H28N2O — CID 137483900
N-propan-2-yl-N'-[(3E,5Z)-2-prop-2-enoxyhepta-1,3,5-trien-3-yl]propane-1,3-diamine (PubChem CID 137483900) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is N-propan-2-yl-N'-[(3E,5Z)-2-prop-2-enoxyhepta-1,3,5-trien-3-yl]propane-1,3-diamine.
| Compound Name | N-propan-2-yl-N'-[(3E,5Z)-2-prop-2-enoxyhepta-1,3,5-trien-3-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 137483900 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | N-propan-2-yl-N'-[(3E,5Z)-2-prop-2-enoxyhepta-1,3,5-trien-3-yl]propane-1,3-diamine |
| SMILES | C=CCOC(=C)/C(=C\C=C/C)NCCCNC(C)C |
| InChI | InChI=1S/C16H28N2O/c1-6-8-10-16(15(5)19-13-7-2)18-12-9-11-17-14(3)4/h6-8,10,14,17-18H,2,5,9,11-13H2,1,3-4H3/b8-6-,16-10+ |
| InChIKey | FLFGNFPZNBFOPK-YTRFMEJKSA-N |
| XLogP | 3.14 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|