C15H31NO — CID 143534296
ethane;(2E,4E)-4-methoxy-N-propylhepta-2,4,6-trien-3-amine (PubChem CID 143534296) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is ethane;(2E,4E)-4-methoxy-N-propylhepta-2,4,6-trien-3-amine.
| Compound Name | ethane;(2E,4E)-4-methoxy-N-propylhepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 143534296 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | ethane;(2E,4E)-4-methoxy-N-propylhepta-2,4,6-trien-3-amine |
| SMILES | C=C/C=C(OC)\C(=C/C)NCCC.CC.CC |
| InChI | InChI=1S/C11H19NO.2C2H6/c1-5-8-11(13-4)10(7-3)12-9-6-2;2*1-2/h5,7-8,12H,1,6,9H2,2-4H3;2*1-2H3/b10-7+,11-8+;; |
| InChIKey | WZUIRYKNBLAANS-VHZUSOFISA-N |
| XLogP | 4.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|