C11H24N2 — CID 163429944
trans-(1S,2R)-N,N-dimethyl-2-[5-(methylamino)pentyl]cyclopropan-1-amine (PubChem CID 163429944) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is trans-(1S,2R)-N,N-dimethyl-2-[5-(methylamino)pentyl]cyclopropan-1-amine.
| Compound Name | trans-(1S,2R)-N,N-dimethyl-2-[5-(methylamino)pentyl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 163429944 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | trans-(1S,2R)-N,N-dimethyl-2-[5-(methylamino)pentyl]cyclopropan-1-amine |
| SMILES | CNCCCCC[C@@H]1C[C@@H]1N(C)C |
| InChI | InChI=1S/C11H24N2/c1-12-8-6-4-5-7-10-9-11(10)13(2)3/h10-12H,4-9H2,1-3H3/t10-,11+/m1/s1 |
| InChIKey | APPSXERDGKLGPA-MNOVXSKESA-N |
| XLogP | 1.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|