C17H22N2O4S — CID 163431387
N-[1-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]thiophene-3-carboxamide (PubChem CID 163431387) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is N-[1-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]thiophene-3-carboxamide.
| Compound Name | N-[1-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 163431387 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N-[1-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]thiophene-3-carboxamide |
| SMILES | CC(C)CC(NC(=O)c1ccsc1)C(=O)N1CC[C@H]2OCC(=O)[C@H]21 |
| InChI | InChI=1S/C17H22N2O4S/c1-10(2)7-12(18-16(21)11-4-6-24-9-11)17(22)19-5-3-14-15(19)13(20)8-23-14/h4,6,9-10,12,14-15H,3,5,7-8H2,1-2H3,(H,18,21)/t12?,14-,15-/m1/s1 |
| InChIKey | AQTYMJWACXZHCO-JENMUQSASA-N |
| XLogP | 1.46 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |