C19H30N2O4S3 — CID 162222449
N-[(2S)-1-[(3aS,7aR)-3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl]-4,4-dimethyl-1-oxopentan-2-yl]thiophene-3-carboxamide;sulfane (PubChem CID 162222449) has the molecular formula C19H30N2O4S3 and a molecular weight of 446.66 g/mol. Its IUPAC name is N-[(2S)-1-[(3aS,7aR)-3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl]-4,4-dimethyl-1-oxopentan-2-yl]thiophene-3-carboxamide;sulfane.
| Compound Name | N-[(2S)-1-[(3aS,7aR)-3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl]-4,4-dimethyl-1-oxopentan-2-yl]thiophene-3-carboxamide;sulfane |
|---|---|
| PubChem CID | 162222449 |
| Molecular Formula | C19H30N2O4S3 |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | N-[(2S)-1-[(3aS,7aR)-3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl]-4,4-dimethyl-1-oxopentan-2-yl]thiophene-3-carboxamide;sulfane |
| SMILES | CC(C)(C)C[C@H](NC(=O)c1ccsc1)C(=O)N1CCC[C@H]2OCC(=O)[C@H]21.S.S |
| InChI | InChI=1S/C19H26N2O4S.2H2S/c1-19(2,3)9-13(20-17(23)12-6-8-26-11-12)18(24)21-7-4-5-15-16(21)14(22)10-25-15;;/h6,8,11,13,15-16H,4-5,7,9-10H2,1-3H3,(H,20,23);2*1H2/t13-,15+,16+;;/m0../s1 |
| InChIKey | ZUHQCVDRLQBRAC-IZQURSCRSA-N |
| XLogP | 2.47 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |