C19H26N2O5 — CID 59791648
N-[(2S)-1-[(3aS,7aR)-3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl]-4,4-dimethyl-1-oxopentan-2-yl]furan-3-carboxamide (PubChem CID 59791648) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is N-[(2S)-1-[(3aS,7aR)-3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl]-4,4-dimethyl-1-oxopentan-2-yl]furan-3-carboxamide.
| Compound Name | N-[(2S)-1-[(3aS,7aR)-3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl]-4,4-dimethyl-1-oxopentan-2-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 59791648 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | N-[(2S)-1-[(3aS,7aR)-3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl]-4,4-dimethyl-1-oxopentan-2-yl]furan-3-carboxamide |
| SMILES | CC(C)(C)C[C@H](NC(=O)c1ccoc1)C(=O)N1CCC[C@H]2OCC(=O)[C@H]21 |
| InChI | InChI=1S/C19H26N2O5/c1-19(2,3)9-13(20-17(23)12-6-8-25-10-12)18(24)21-7-4-5-15-16(21)14(22)11-26-15/h6,8,10,13,15-16H,4-5,7,9,11H2,1-3H3,(H,20,23)/t13-,15+,16+/m0/s1 |
| InChIKey | YXUOJAFGCSDEHA-NUEKZKHPSA-N |
| XLogP | 1.77 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |