C29H41N3O4 — CID 66986596
N-[1-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4,4-dimethyl-1-oxopentan-2-yl]-4-(1-cyclobutylpiperidin-4-yl)benzamide (PubChem CID 66986596) has the molecular formula C29H41N3O4 and a molecular weight of 495.66 g/mol. Its IUPAC name is N-[1-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4,4-dimethyl-1-oxopentan-2-yl]-4-(1-cyclobutylpiperidin-4-yl)benzamide.
| Compound Name | N-[1-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4,4-dimethyl-1-oxopentan-2-yl]-4-(1-cyclobutylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 66986596 |
| Molecular Formula | C29H41N3O4 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.31 |
| IUPAC Name | N-[1-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4,4-dimethyl-1-oxopentan-2-yl]-4-(1-cyclobutylpiperidin-4-yl)benzamide |
| SMILES | CC(C)(C)CC(NC(=O)c1ccc(C2CCN(C3CCC3)CC2)cc1)C(=O)N1CC[C@H]2OCC(=O)[C@H]21 |
| InChI | InChI=1S/C29H41N3O4/c1-29(2,3)17-23(28(35)32-16-13-25-26(32)24(33)18-36-25)30-27(34)21-9-7-19(8-10-21)20-11-14-31(15-12-20)22-5-4-6-22/h7-10,20,22-23,25-26H,4-6,11-18H2,1-3H3,(H,30,34)/t23?,25-,26-/m1/s1 |
| InChIKey | NHKFCQKBYMGJHC-NYJWAPBASA-N |
| XLogP | 3.52 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |