C27H37N3O4 — CID 66986687
N-[1-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-3-methyl-1-oxopentan-2-yl]-4-(1-cyclopropylpiperidin-4-yl)benzamide (PubChem CID 66986687) has the molecular formula C27H37N3O4 and a molecular weight of 467.61 g/mol. Its IUPAC name is N-[1-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-3-methyl-1-oxopentan-2-yl]-4-(1-cyclopropylpiperidin-4-yl)benzamide.
| Compound Name | N-[1-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-3-methyl-1-oxopentan-2-yl]-4-(1-cyclopropylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 66986687 |
| Molecular Formula | C27H37N3O4 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | N-[1-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-3-methyl-1-oxopentan-2-yl]-4-(1-cyclopropylpiperidin-4-yl)benzamide |
| SMILES | CCC(C)C(NC(=O)c1ccc(C2CCN(C3CC3)CC2)cc1)C(=O)N1CC[C@H]2OCC(=O)[C@H]21 |
| InChI | InChI=1S/C27H37N3O4/c1-3-17(2)24(27(33)30-15-12-23-25(30)22(31)16-34-23)28-26(32)20-6-4-18(5-7-20)19-10-13-29(14-11-19)21-8-9-21/h4-7,17,19,21,23-25H,3,8-16H2,1-2H3,(H,28,32)/t17?,23-,24?,25-/m1/s1 |
| InChIKey | TVKAEXCAYYWJPS-DIGJMJCQSA-N |
| XLogP | 2.74 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |