C21H32N2O5S2 — CID 159749756
N-[(2S)-1-[(3aS,7aR)-3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl]-3-cyclohexyl-1-oxopropan-2-yl]furan-3-carboxamide;sulfane (PubChem CID 159749756) has the molecular formula C21H32N2O5S2 and a molecular weight of 456.63 g/mol. Its IUPAC name is N-[(2S)-1-[(3aS,7aR)-3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl]-3-cyclohexyl-1-oxopropan-2-yl]furan-3-carboxamide;sulfane.
| Compound Name | N-[(2S)-1-[(3aS,7aR)-3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl]-3-cyclohexyl-1-oxopropan-2-yl]furan-3-carboxamide;sulfane |
|---|---|
| PubChem CID | 159749756 |
| Molecular Formula | C21H32N2O5S2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N-[(2S)-1-[(3aS,7aR)-3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl]-3-cyclohexyl-1-oxopropan-2-yl]furan-3-carboxamide;sulfane |
| SMILES | O=C(N[C@@H](CC1CCCCC1)C(=O)N1CCC[C@H]2OCC(=O)[C@H]21)c1ccoc1.S.S |
| InChI | InChI=1S/C21H28N2O5.2H2S/c24-17-13-28-18-7-4-9-23(19(17)18)21(26)16(11-14-5-2-1-3-6-14)22-20(25)15-8-10-27-12-15;;/h8,10,12,14,16,18-19H,1-7,9,11,13H2,(H,22,25);2*1H2/t16-,18+,19+;;/m0../s1 |
| InChIKey | NDMTUBOHPISZJH-DEEQDPHJSA-N |
| XLogP | 2.53 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |