C14H18NO4+ — CID 163432580
1-[2-[2-(2-carboxyethylamino)-2-oxoethyl]phenyl]propan-2-ylideneoxidanium (PubChem CID 163432580) has the molecular formula C14H18NO4+ and a molecular weight of 264.30 g/mol. Its IUPAC name is 1-[2-[2-(2-carboxyethylamino)-2-oxoethyl]phenyl]propan-2-ylideneoxidanium.
| Compound Name | 1-[2-[2-(2-carboxyethylamino)-2-oxoethyl]phenyl]propan-2-ylideneoxidanium |
|---|---|
| PubChem CID | 163432580 |
| Molecular Formula | C14H18NO4+ |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1-[2-[2-(2-carboxyethylamino)-2-oxoethyl]phenyl]propan-2-ylideneoxidanium |
| SMILES | [H]/[O+]=C(\C)Cc1ccccc1CC(=O)NCCC(=O)O |
| InChI | InChI=1S/C14H17NO4/c1-10(16)8-11-4-2-3-5-12(11)9-13(17)15-7-6-14(18)19/h2-5H,6-9H2,1H3,(H,15,17)(H,18,19)/p+1 |
| InChIKey | ARTUYYHFSCTFAT-UHFFFAOYSA-O |
| XLogP | 0.93 |
| TPSA | 87.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|