C16H18FN3O2 — CID 163432718
(E)-3-[1-(3-fluorophenyl)ethylideneamino]-2-methyl-N-(2-oxopyrrolidin-3-yl)prop-2-enamide (PubChem CID 163432718) has the molecular formula C16H18FN3O2 and a molecular weight of 303.34 g/mol. Its IUPAC name is (E)-3-[1-(3-fluorophenyl)ethylideneamino]-2-methyl-N-(2-oxopyrrolidin-3-yl)prop-2-enamide.
| Compound Name | (E)-3-[1-(3-fluorophenyl)ethylideneamino]-2-methyl-N-(2-oxopyrrolidin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 163432718 |
| Molecular Formula | C16H18FN3O2 |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | (E)-3-[1-(3-fluorophenyl)ethylideneamino]-2-methyl-N-(2-oxopyrrolidin-3-yl)prop-2-enamide |
| SMILES | C/C(=C\N=C(/C)c1cccc(F)c1)C(=O)NC1CCNC1=O |
| InChI | InChI=1S/C16H18FN3O2/c1-10(15(21)20-14-6-7-18-16(14)22)9-19-11(2)12-4-3-5-13(17)8-12/h3-5,8-9,14H,6-7H2,1-2H3,(H,18,22)(H,20,21)/b10-9+,19-11+ |
| InChIKey | ARWLBBRYVOQGCR-FWTLAULQSA-N |
| XLogP | 1.54 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|