C33H20N6S2 — CID 163434984
1-(5-carbazol-9-yl-2-pyridinyl)-2-[5-(4-phenyl-1,3,5-triazin-2-yl)-2-pyridinyl]ethane-1,2-dithione (PubChem CID 163434984) has the molecular formula C33H20N6S2 and a molecular weight of 564.70 g/mol. Its IUPAC name is 1-(5-carbazol-9-yl-2-pyridinyl)-2-[5-(4-phenyl-1,3,5-triazin-2-yl)-2-pyridinyl]ethane-1,2-dithione.
| Compound Name | 1-(5-carbazol-9-yl-2-pyridinyl)-2-[5-(4-phenyl-1,3,5-triazin-2-yl)-2-pyridinyl]ethane-1,2-dithione |
|---|---|
| PubChem CID | 163434984 |
| Molecular Formula | C33H20N6S2 |
| Molecular Weight | 564.70 g/mol |
| Exact Mass | 564.12 |
| IUPAC Name | 1-(5-carbazol-9-yl-2-pyridinyl)-2-[5-(4-phenyl-1,3,5-triazin-2-yl)-2-pyridinyl]ethane-1,2-dithione |
| SMILES | S=C(C(=S)c1ccc(-n2c3ccccc3c3ccccc32)cn1)c1ccc(-c2ncnc(-c3ccccc3)n2)cn1 |
| InChI | InChI=1S/C33H20N6S2/c40-30(26-16-14-22(18-34-26)33-37-20-36-32(38-33)21-8-2-1-3-9-21)31(41)27-17-15-23(19-35-27)39-28-12-6-4-10-24(28)25-11-5-7-13-29(25)39/h1-20H |
| InChIKey | ATRXUFRPFOMXRS-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.70 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|