C38H25IrN5-2 — CID 140812307
iridium;4-phenyl-2-phenyl-1,3,5-triazine;9-(6-phenyl-3-pyridinyl)carbazole (PubChem CID 140812307) has the molecular formula C38H25IrN5-2 and a molecular weight of 743.87 g/mol. Its IUPAC name is iridium;4-phenyl-2-phenyl-1,3,5-triazine;9-(6-phenyl-3-pyridinyl)carbazole.
| Compound Name | iridium;4-phenyl-2-phenyl-1,3,5-triazine;9-(6-phenyl-3-pyridinyl)carbazole |
|---|---|
| PubChem CID | 140812307 |
| Molecular Formula | C38H25IrN5-2 |
| Molecular Weight | 743.87 g/mol |
| Exact Mass | 744.18 |
| IUPAC Name | iridium;4-phenyl-2-phenyl-1,3,5-triazine;9-(6-phenyl-3-pyridinyl)carbazole |
| SMILES | [Ir].[c-]1ccccc1-c1ccc(-n2c3ccccc3c3ccccc32)cn1.[c-]1ccccc1-c1ncnc(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H15N2.C15H10N3.Ir/c1-2-8-17(9-3-1)21-15-14-18(16-24-21)25-22-12-6-4-10-19(22)20-11-5-7-13-23(20)25;1-3-7-12(8-4-1)14-16-11-17-15(18-14)13-9-5-2-6-10-13;/h1-8,10-16H;1-9,11H;/q2*-1; |
| InChIKey | BEFRWHQUXIFCFK-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.87 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|