C8H7F2NO — CID 163436912
5,6-difluoro-1,3-dihydro-2-benzofuran-1-amine (PubChem CID 163436912) has the molecular formula C8H7F2NO and a molecular weight of 171.15 g/mol. Its IUPAC name is 5,6-difluoro-1,3-dihydro-2-benzofuran-1-amine.
| Compound Name | 5,6-difluoro-1,3-dihydro-2-benzofuran-1-amine |
|---|---|
| PubChem CID | 163436912 |
| Molecular Formula | C8H7F2NO |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 5,6-difluoro-1,3-dihydro-2-benzofuran-1-amine |
| SMILES | NC1OCc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C8H7F2NO/c9-6-1-4-3-12-8(11)5(4)2-7(6)10/h1-2,8H,3,11H2 |
| InChIKey | AVHALGRRVMFWFQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |