C22H34N2O — CID 163438818
N-(1-adamantyl)-3-ethenyl-1-methyl-7-azaspiro[3.5]nonane-7-carboxamide (PubChem CID 163438818) has the molecular formula C22H34N2O and a molecular weight of 342.53 g/mol. Its IUPAC name is N-(1-adamantyl)-3-ethenyl-1-methyl-7-azaspiro[3.5]nonane-7-carboxamide.
| Compound Name | N-(1-adamantyl)-3-ethenyl-1-methyl-7-azaspiro[3.5]nonane-7-carboxamide |
|---|---|
| PubChem CID | 163438818 |
| Molecular Formula | C22H34N2O |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.27 |
| IUPAC Name | N-(1-adamantyl)-3-ethenyl-1-methyl-7-azaspiro[3.5]nonane-7-carboxamide |
| SMILES | C=CC1CC(C)C12CCN(C(=O)NC13CC4CC(CC(C4)C1)C3)CC2 |
| InChI | InChI=1S/C22H34N2O/c1-3-19-8-15(2)22(19)4-6-24(7-5-22)20(25)23-21-12-16-9-17(13-21)11-18(10-16)14-21/h3,15-19H,1,4-14H2,2H3,(H,23,25) |
| InChIKey | AWUIFAIPJUJTTB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|