C12H16O3 — CID 163439614
(5aS,9aR)-9a-hydroxy-2,3,4,5a,6,7,8,9-octahydrodibenzofuran-1-one (PubChem CID 163439614) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (5aS,9aR)-9a-hydroxy-2,3,4,5a,6,7,8,9-octahydrodibenzofuran-1-one.
| Compound Name | (5aS,9aR)-9a-hydroxy-2,3,4,5a,6,7,8,9-octahydrodibenzofuran-1-one |
|---|---|
| PubChem CID | 163439614 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (5aS,9aR)-9a-hydroxy-2,3,4,5a,6,7,8,9-octahydrodibenzofuran-1-one |
| SMILES | O=C1CCCC2=C1[C@]1(O)CCCC[C@@H]1O2 |
| InChI | InChI=1S/C12H16O3/c13-8-4-3-5-9-11(8)12(14)7-2-1-6-10(12)15-9/h10,14H,1-7H2/t10-,12-/m0/s1 |
| InChIKey | AXKBZGPNDDZLBR-JQWIXIFHSA-N |
| XLogP | 1.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |