C14H20O3 — CID 132528171
(5aS,9aR)-9a-hydroxy-3,3-dimethyl-4,5a,6,7,8,9-hexahydro-2H-dibenzofuran-1-one (PubChem CID 132528171) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (5aS,9aR)-9a-hydroxy-3,3-dimethyl-4,5a,6,7,8,9-hexahydro-2H-dibenzofuran-1-one.
| Compound Name | (5aS,9aR)-9a-hydroxy-3,3-dimethyl-4,5a,6,7,8,9-hexahydro-2H-dibenzofuran-1-one |
|---|---|
| PubChem CID | 132528171 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (5aS,9aR)-9a-hydroxy-3,3-dimethyl-4,5a,6,7,8,9-hexahydro-2H-dibenzofuran-1-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)O[C@H]1CCCC[C@@]21O |
| InChI | InChI=1S/C14H20O3/c1-13(2)7-9(15)12-10(8-13)17-11-5-3-4-6-14(11,12)16/h11,16H,3-8H2,1-2H3/t11-,14-/m0/s1 |
| InChIKey | ABSVICMNEZGSDC-FZMZJTMJSA-N |
| XLogP | 2.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |