C9H9F7O3 — CID 163439674
methyl (E)-4,5,5,5-tetrafluoro-2,3-dimethyl-4-(trifluoromethoxy)pent-2-enoate (PubChem CID 163439674) has the molecular formula C9H9F7O3 and a molecular weight of 298.15 g/mol. Its IUPAC name is methyl (E)-4,5,5,5-tetrafluoro-2,3-dimethyl-4-(trifluoromethoxy)pent-2-enoate.
| Compound Name | methyl (E)-4,5,5,5-tetrafluoro-2,3-dimethyl-4-(trifluoromethoxy)pent-2-enoate |
|---|---|
| PubChem CID | 163439674 |
| Molecular Formula | C9H9F7O3 |
| Molecular Weight | 298.15 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | methyl (E)-4,5,5,5-tetrafluoro-2,3-dimethyl-4-(trifluoromethoxy)pent-2-enoate |
| SMILES | COC(=O)/C(C)=C(\C)C(F)(OC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H9F7O3/c1-4(6(17)18-3)5(2)7(10,8(11,12)13)19-9(14,15)16/h1-3H3/b5-4+ |
| InChIKey | AXLMDWZYSKJJPF-SNAWJCMRSA-N |
| XLogP | 3.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.15 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|