C25H34N6O2 — CID 163444065
2-amino-5-[[amino(hydroxy)methyl]amino]-N'-ethenyl-N-[(2E,4E)-5-[(2E,4Z)-6-iminohepta-2,4-dien-3-yl]oxy-6-methylhepta-2,4,6-trien-2-yl]benzenecarboximidamide (PubChem CID 163444065) has the molecular formula C25H34N6O2 and a molecular weight of 450.59 g/mol. Its IUPAC name is 2-amino-5-[[amino(hydroxy)methyl]amino]-N'-ethenyl-N-[(2E,4E)-5-[(2E,4Z)-6-iminohepta-2,4-dien-3-yl]oxy-6-methylhepta-2,4,6-trien-2-yl]benzenecarboximidamide.
| Compound Name | 2-amino-5-[[amino(hydroxy)methyl]amino]-N'-ethenyl-N-[(2E,4E)-5-[(2E,4Z)-6-iminohepta-2,4-dien-3-yl]oxy-6-methylhepta-2,4,6-trien-2-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 163444065 |
| Molecular Formula | C25H34N6O2 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | 2-amino-5-[[amino(hydroxy)methyl]amino]-N'-ethenyl-N-[(2E,4E)-5-[(2E,4Z)-6-iminohepta-2,4-dien-3-yl]oxy-6-methylhepta-2,4,6-trien-2-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(C)\C=C/C(=C\C)O/C(=C/C=C(\C)N/C(=N\C=C)c1cc(NC(N)O)ccc1N)C(=C)C |
| InChI | InChI=1S/C25H34N6O2/c1-7-20(12-9-17(5)26)33-23(16(3)4)14-10-18(6)30-24(29-8-2)21-15-19(31-25(28)32)11-13-22(21)27/h7-15,25-26,31-32H,2-3,27-28H2,1,4-6H3,(H,29,30)/b12-9-,18-10+,20-7+,23-14+,26-17- |
| InChIKey | BAZUOYQZUFQIJT-VCAQPKCASA-N |
| XLogP | 4.28 |
| TPSA | 141.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|