C19H21F3N2O3S — CID 163445844
amino 2-[[2-(cyclohexylmethoxy)-5-(trifluoromethyl)phenyl]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 163445844) has the molecular formula C19H21F3N2O3S and a molecular weight of 414.45 g/mol. Its IUPAC name is amino 2-[[2-(cyclohexylmethoxy)-5-(trifluoromethyl)phenyl]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | amino 2-[[2-(cyclohexylmethoxy)-5-(trifluoromethyl)phenyl]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 163445844 |
| Molecular Formula | C19H21F3N2O3S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | amino 2-[[2-(cyclohexylmethoxy)-5-(trifluoromethyl)phenyl]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | NOC(=O)c1csc(Cc2cc(C(F)(F)F)ccc2OCC2CCCCC2)n1 |
| InChI | InChI=1S/C19H21F3N2O3S/c20-19(21,22)14-6-7-16(26-10-12-4-2-1-3-5-12)13(8-14)9-17-24-15(11-28-17)18(25)27-23/h6-8,11-12H,1-5,9-10,23H2 |
| InChIKey | FOSJOEOHOBMTSX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|