C37H42Cl2N6O4 — CID 163447555
3-(cyclopropylmethoxy)-5-[3-[5-[(3,5-dichloro-4-pyridinyl)carbamoylamino]-1-ethyl-6-oxopyridazin-3-yl]phenyl]-N-octylbenzamide (PubChem CID 163447555) has the molecular formula C37H42Cl2N6O4 and a molecular weight of 705.69 g/mol. Its IUPAC name is 3-(cyclopropylmethoxy)-5-[3-[5-[(3,5-dichloro-4-pyridinyl)carbamoylamino]-1-ethyl-6-oxopyridazin-3-yl]phenyl]-N-octylbenzamide.
| Compound Name | 3-(cyclopropylmethoxy)-5-[3-[5-[(3,5-dichloro-4-pyridinyl)carbamoylamino]-1-ethyl-6-oxopyridazin-3-yl]phenyl]-N-octylbenzamide |
|---|---|
| PubChem CID | 163447555 |
| Molecular Formula | C37H42Cl2N6O4 |
| Molecular Weight | 705.69 g/mol |
| Exact Mass | 704.26 |
| IUPAC Name | 3-(cyclopropylmethoxy)-5-[3-[5-[(3,5-dichloro-4-pyridinyl)carbamoylamino]-1-ethyl-6-oxopyridazin-3-yl]phenyl]-N-octylbenzamide |
| SMILES | CCCCCCCCNC(=O)c1cc(OCC2CC2)cc(-c2cccc(-c3cc(NC(=O)Nc4c(Cl)cncc4Cl)c(=O)n(CC)n3)c2)c1 |
| InChI | InChI=1S/C37H42Cl2N6O4/c1-3-5-6-7-8-9-15-41-35(46)28-17-27(18-29(19-28)49-23-24-13-14-24)25-11-10-12-26(16-25)32-20-33(36(47)45(4-2)44-32)42-37(48)43-34-30(38)21-40-22-31(34)39/h10-12,16-22,24H,3-9,13-15,23H2,1-2H3,(H,41,46)(H2,40,42,43,48) |
| InChIKey | BDUJWNZKGLZCLU-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 127.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.69 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|