C30H31Cl2N7O3 — CID 46238637
3-[3-[5-[(3,5-dichloro-4-pyridinyl)carbamoylamino]-1-ethyl-6-oxopyridazin-3-yl]phenyl]-N-[3-(dimethylamino)propyl]benzamide (PubChem CID 46238637) has the molecular formula C30H31Cl2N7O3 and a molecular weight of 608.53 g/mol. Its IUPAC name is 3-[3-[5-[(3,5-dichloro-4-pyridinyl)carbamoylamino]-1-ethyl-6-oxopyridazin-3-yl]phenyl]-N-[3-(dimethylamino)propyl]benzamide.
| Compound Name | 3-[3-[5-[(3,5-dichloro-4-pyridinyl)carbamoylamino]-1-ethyl-6-oxopyridazin-3-yl]phenyl]-N-[3-(dimethylamino)propyl]benzamide |
|---|---|
| PubChem CID | 46238637 |
| Molecular Formula | C30H31Cl2N7O3 |
| Molecular Weight | 608.53 g/mol |
| Exact Mass | 607.19 |
| IUPAC Name | 3-[3-[5-[(3,5-dichloro-4-pyridinyl)carbamoylamino]-1-ethyl-6-oxopyridazin-3-yl]phenyl]-N-[3-(dimethylamino)propyl]benzamide |
| SMILES | CCn1nc(-c2cccc(-c3cccc(C(=O)NCCCN(C)C)c3)c2)cc(NC(=O)Nc2c(Cl)cncc2Cl)c1=O |
| InChI | InChI=1S/C30H31Cl2N7O3/c1-4-39-29(41)26(35-30(42)36-27-23(31)17-33-18-24(27)32)16-25(37-39)21-10-5-8-19(14-21)20-9-6-11-22(15-20)28(40)34-12-7-13-38(2)3/h5-6,8-11,14-18H,4,7,12-13H2,1-3H3,(H,34,40)(H2,33,35,36,42) |
| InChIKey | IXNMTEOMWWFGKO-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 121.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|