C24H43N3 — CID 163448420
1-N,2-N,3-N-tricyclohexyl-1-N,2-N,3-N-trimethylcyclopropene-1,2,3-triamine (PubChem CID 163448420) has the molecular formula C24H43N3 and a molecular weight of 373.63 g/mol. Its IUPAC name is 1-N,2-N,3-N-tricyclohexyl-1-N,2-N,3-N-trimethylcyclopropene-1,2,3-triamine.
| Compound Name | 1-N,2-N,3-N-tricyclohexyl-1-N,2-N,3-N-trimethylcyclopropene-1,2,3-triamine |
|---|---|
| PubChem CID | 163448420 |
| Molecular Formula | C24H43N3 |
| Molecular Weight | 373.63 g/mol |
| Exact Mass | 373.35 |
| IUPAC Name | 1-N,2-N,3-N-tricyclohexyl-1-N,2-N,3-N-trimethylcyclopropene-1,2,3-triamine |
| SMILES | CN(C1=C(N(C)C2CCCCC2)C1N(C)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C24H43N3/c1-25(19-13-7-4-8-14-19)22-23(26(2)20-15-9-5-10-16-20)24(22)27(3)21-17-11-6-12-18-21/h19-22H,4-18H2,1-3H3 |
| InChIKey | BEMMSTJVDCBDET-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.63 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |