About N-cyclohexyl-N-methylcyclohexanamine;1-methylpyrrolidin-2-one
N-cyclohexyl-N-methylcyclohexanamine;1-methylpyrrolidin-2-one (PubChem CID 131739968) has the molecular formula C18H34N2O
and a molecular weight of 294.48 g/mol. Its IUPAC name is N-cyclohexyl-N-methylcyclohexanamine;1-methylpyrrolidin-2-one.
Molecular Properties
| Compound Name | N-cyclohexyl-N-methylcyclohexanamine;1-methylpyrrolidin-2-one |
| PubChem CID | 131739968 |
| Molecular Formula | C18H34N2O |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.27 |
| IUPAC Name | N-cyclohexyl-N-methylcyclohexanamine;1-methylpyrrolidin-2-one |
| SMILES | CN(C1CCCCC1)C1CCCCC1.CN1CCCC1=O |
| InChI | InChI=1S/C13H25N.C5H9NO/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;1-6-4-2-3-5(6)7/h12-13H,2-11H2,1H3;2-4H2,1H3 |
| InChIKey | PUHCJJZTZNBWSG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclohexyl-N-methylcyclohexanamine;1-methylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-N-methylcyclohexanamine;1-methylpyrrolidin-2-one?
The IUPAC name of N-cyclohexyl-N-methylcyclohexanamine;1-methylpyrrolidin-2-one (CID 131739968) is N-cyclohexyl-N-methylcyclohexanamine;1-methylpyrrolidin-2-one.
What is the SMILES notation for N-cyclohexyl-N-methylcyclohexanamine;1-methylpyrrolidin-2-one?
The canonical SMILES for N-cyclohexyl-N-methylcyclohexanamine;1-methylpyrrolidin-2-one is CN(C1CCCCC1)C1CCCCC1.CN1CCCC1=O.
What is the InChIKey of N-cyclohexyl-N-methylcyclohexanamine;1-methylpyrrolidin-2-one?
The InChIKey is PUHCJJZTZNBWSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N.C5H9NO/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;1-6-4-2-3-5(6)7/h12-13H,2-11H2,1H3;2-4H2,1H3.
What are the key properties of N-cyclohexyl-N-methylcyclohexanamine;1-methylpyrrolidin-2-one?
N-cyclohexyl-N-methylcyclohexanamine;1-methylpyrrolidin-2-one has a molecular weight of 294.48 g/mol, XLogP of 3.82, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-N-methylcyclohexanamine;1-methylpyrrolidin-2-one is sourced from PubChem (CID 131739968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).