C8H15N — CID 163452027
N-[(Z,3S)-2,3-dimethylpent-1-enyl]methanimine (PubChem CID 163452027) has the molecular formula C8H15N and a molecular weight of 125.21 g/mol. Its IUPAC name is N-[(Z,3S)-2,3-dimethylpent-1-enyl]methanimine.
| Compound Name | N-[(Z,3S)-2,3-dimethylpent-1-enyl]methanimine |
|---|---|
| PubChem CID | 163452027 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | N-[(Z,3S)-2,3-dimethylpent-1-enyl]methanimine |
| SMILES | C=N/C=C(/C)[C@@H](C)CC |
| InChI | InChI=1S/C8H15N/c1-5-7(2)8(3)6-9-4/h6-7H,4-5H2,1-3H3/b8-6-/t7-/m0/s1 |
| InChIKey | BHKDJRKGAXTOAN-VQKCLUMFSA-N |
| XLogP | 2.64 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|