C26H30ClN6O3S- — CID 163452300
5-chloro-N-[(2R,4S)-4-(dimethylcarbamoyl)-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]cyclohexyl]-1H-indole-2-carboximidate (PubChem CID 163452300) has the molecular formula C26H30ClN6O3S- and a molecular weight of 542.09 g/mol. Its IUPAC name is 5-chloro-N-[(2R,4S)-4-(dimethylcarbamoyl)-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]cyclohexyl]-1H-indole-2-carboximidate.
| Compound Name | 5-chloro-N-[(2R,4S)-4-(dimethylcarbamoyl)-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]cyclohexyl]-1H-indole-2-carboximidate |
|---|---|
| PubChem CID | 163452300 |
| Molecular Formula | C26H30ClN6O3S- |
| Molecular Weight | 542.09 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | 5-chloro-N-[(2R,4S)-4-(dimethylcarbamoyl)-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]cyclohexyl]-1H-indole-2-carboximidate |
| SMILES | CN1CCc2nc(C(=O)N[C@@H]3C[C@@H](C(=O)N(C)C)CCC3/N=C(\[O-])c3cc4cc(Cl)ccc4[nH]3)sc2C1 |
| InChI | InChI=1S/C26H31ClN6O3S/c1-32(2)26(36)14-4-6-18(29-23(34)21-12-15-10-16(27)5-7-17(15)28-21)20(11-14)30-24(35)25-31-19-8-9-33(3)13-22(19)37-25/h5,7,10,12,14,18,20,28H,4,6,8-9,11,13H2,1-3H3,(H,29,34)(H,30,35)/p-1/t14-,18?,20+/m0/s1 |
| InChIKey | SZBHQQIIGORYND-GCZMORHFSA-M |
| XLogP | 2.43 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.09 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|