C24H27ClN6O3S — CID 68907650
N-[(1S,2R,5R)-5-carbamoyl-2-[(5-chloro-1H-indole-2-carbonyl)amino]cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 68907650) has the molecular formula C24H27ClN6O3S and a molecular weight of 515.04 g/mol. Its IUPAC name is N-[(1S,2R,5R)-5-carbamoyl-2-[(5-chloro-1H-indole-2-carbonyl)amino]cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | N-[(1S,2R,5R)-5-carbamoyl-2-[(5-chloro-1H-indole-2-carbonyl)amino]cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 68907650 |
| Molecular Formula | C24H27ClN6O3S |
| Molecular Weight | 515.04 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | N-[(1S,2R,5R)-5-carbamoyl-2-[(5-chloro-1H-indole-2-carbonyl)amino]cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | CN1CCc2nc(C(=O)N[C@H]3C[C@H](C(N)=O)CCC3NC(=O)c3cc4cc(Cl)ccc4[nH]3)sc2C1 |
| InChI | InChI=1S/C24H27ClN6O3S/c1-31-7-6-17-20(11-31)35-24(30-17)23(34)29-18-9-12(21(26)32)2-4-16(18)28-22(33)19-10-13-8-14(25)3-5-15(13)27-19/h3,5,8,10,12,16,18,27H,2,4,6-7,9,11H2,1H3,(H2,26,32)(H,28,33)(H,29,34)/t12-,16?,18+/m1/s1 |
| InChIKey | CXWXBHYLQAPFKL-ZAYVCONHSA-N |
| XLogP | 2.45 |
| TPSA | 133.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.04 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |