C27H32ClN5O3S — CID 58208868
N-[(1R,2S,5S)-5-butanoyl-2-[(5-chloro-1H-indole-2-carbonyl)amino]cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 58208868) has the molecular formula C27H32ClN5O3S and a molecular weight of 542.11 g/mol. Its IUPAC name is N-[(1R,2S,5S)-5-butanoyl-2-[(5-chloro-1H-indole-2-carbonyl)amino]cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | N-[(1R,2S,5S)-5-butanoyl-2-[(5-chloro-1H-indole-2-carbonyl)amino]cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 58208868 |
| Molecular Formula | C27H32ClN5O3S |
| Molecular Weight | 542.11 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | N-[(1R,2S,5S)-5-butanoyl-2-[(5-chloro-1H-indole-2-carbonyl)amino]cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | CCCC(=O)[C@H]1CCC(NC(=O)c2cc3cc(Cl)ccc3[nH]2)[C@H](NC(=O)c2nc3c(s2)CN(C)CC3)C1 |
| InChI | InChI=1S/C27H32ClN5O3S/c1-3-4-23(34)15-5-7-19(30-25(35)22-13-16-11-17(28)6-8-18(16)29-22)21(12-15)31-26(36)27-32-20-9-10-33(2)14-24(20)37-27/h6,8,11,13,15,19,21,29H,3-5,7,9-10,12,14H2,1-2H3,(H,30,35)(H,31,36)/t15-,19?,21+/m0/s1 |
| InChIKey | HLPNCCQDMYTTMN-NIGAHDQZSA-N |
| XLogP | 4.33 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.11 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |