C28H32ClN5O3S — CID 58208873
N-[(1R,2S,5S)-2-[(5-chloro-1H-indole-2-carbonyl)amino]-5-(2-cyclopropylacetyl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 58208873) has the molecular formula C28H32ClN5O3S and a molecular weight of 554.12 g/mol. Its IUPAC name is N-[(1R,2S,5S)-2-[(5-chloro-1H-indole-2-carbonyl)amino]-5-(2-cyclopropylacetyl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | N-[(1R,2S,5S)-2-[(5-chloro-1H-indole-2-carbonyl)amino]-5-(2-cyclopropylacetyl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 58208873 |
| Molecular Formula | C28H32ClN5O3S |
| Molecular Weight | 554.12 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | N-[(1R,2S,5S)-2-[(5-chloro-1H-indole-2-carbonyl)amino]-5-(2-cyclopropylacetyl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | CN1CCc2nc(C(=O)N[C@@H]3C[C@@H](C(=O)CC4CC4)CCC3NC(=O)c3cc4cc(Cl)ccc4[nH]3)sc2C1 |
| InChI | InChI=1S/C28H32ClN5O3S/c1-34-9-8-21-25(14-34)38-28(33-21)27(37)32-22-12-16(24(35)10-15-2-3-15)4-6-20(22)31-26(36)23-13-17-11-18(29)5-7-19(17)30-23/h5,7,11,13,15-16,20,22,30H,2-4,6,8-10,12,14H2,1H3,(H,31,36)(H,32,37)/t16-,20?,22+/m0/s1 |
| InChIKey | NSLHUGFJHAAPID-XAYSJMGHSA-N |
| XLogP | 4.33 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.12 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |